C27H34ClN3O2 — CID 20957957
4-[[3-[benzyl(propan-2-yl)amino]propylamino]methyl]-1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 20957957) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 4-[[3-[benzyl(propan-2-yl)amino]propylamino]methyl]-1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 4-[[3-[benzyl(propan-2-yl)amino]propylamino]methyl]-1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 20957957 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 4-[[3-[benzyl(propan-2-yl)amino]propylamino]methyl]-1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | Cc1c(CNCCCN(Cc2ccccc2)C(C)C)c(C(=O)O)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H34ClN3O2/c1-19(2)30(18-22-9-6-5-7-10-22)16-8-15-29-17-25-20(3)31(21(4)26(25)27(32)33)24-13-11-23(28)12-14-24/h5-7,9-14,19,29H,8,15-18H2,1-4H3,(H,32,33) |
| InChIKey | XDVHZBYGTMOLJP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|