C16H16ClF3N4O3 — CID 2095796
ethyl (5S,6S,7R)-7-(4-chlorophenyl)-5-hydroxy-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 2095796) has the molecular formula C16H16ClF3N4O3 and a molecular weight of 404.78 g/mol. Its IUPAC name is ethyl (5S,6S,7R)-7-(4-chlorophenyl)-5-hydroxy-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5S,6S,7R)-7-(4-chlorophenyl)-5-hydroxy-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 2095796 |
| Molecular Formula | C16H16ClF3N4O3 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | ethyl (5S,6S,7R)-7-(4-chlorophenyl)-5-hydroxy-5-methyl-2-(trifluoromethyl)-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccc(Cl)cc2)n2nc(C(F)(F)F)nc2N[C@@]1(C)O |
| InChI | InChI=1S/C16H16ClF3N4O3/c1-3-27-12(25)10-11(8-4-6-9(17)7-5-8)24-14(22-15(10,2)26)21-13(23-24)16(18,19)20/h4-7,10-11,26H,3H2,1-2H3,(H,21,22,23)/t10-,11+,15+/m1/s1 |
| InChIKey | HZMHDVJGOYRAGL-ZETOZRRWSA-N |
| XLogP | 2.85 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |