C30H35N5O3 — CID 20962102
1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 20962102) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20962102 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[(3-methoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc3c(N4CCC(C(=O)NCc5cccc(OC)c5)CC4)nccn3n2)cc1 |
| InChI | InChI=1S/C30H35N5O3/c1-3-4-18-38-25-10-8-23(9-11-25)27-20-28-29(31-14-17-35(28)33-27)34-15-12-24(13-16-34)30(36)32-21-22-6-5-7-26(19-22)37-2/h5-11,14,17,19-20,24H,3-4,12-13,15-16,18,21H2,1-2H3,(H,32,36) |
| InChIKey | WGSORLKURURUSC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|