C30H35N5O2 — CID 46346478
N-benzyl-1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-methylpiperidine-4-carboxamide (PubChem CID 46346478) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-benzyl-1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46346478 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | N-benzyl-1-[2-(4-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc3c(N4CCC(C(=O)N(C)Cc5ccccc5)CC4)nccn3n2)cc1 |
| InChI | InChI=1S/C30H35N5O2/c1-3-4-20-37-26-12-10-24(11-13-26)27-21-28-29(31-16-19-35(28)32-27)34-17-14-25(15-18-34)30(36)33(2)22-23-8-6-5-7-9-23/h5-13,16,19,21,25H,3-4,14-15,17-18,20,22H2,1-2H3 |
| InChIKey | MGVFJSZEGCENCL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|