C29H33N5O3 — CID 50797076
1-[2-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 50797076) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50797076 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 1-[2-(3,4-dimethylphenyl)pyrazolo[1,5-a]pyrazin-4-yl]-N-[2-(2-methoxyphenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1OCCNC(=O)C1CCN(c2nccn3nc(-c4ccc(C)c(C)c4)cc23)CC1 |
| InChI | InChI=1S/C29H33N5O3/c1-20-8-9-23(18-21(20)2)24-19-25-28(30-12-16-34(25)32-24)33-14-10-22(11-15-33)29(35)31-13-17-37-27-7-5-4-6-26(27)36-3/h4-9,12,16,18-19,22H,10-11,13-15,17H2,1-3H3,(H,31,35) |
| InChIKey | KGYOXTZDIXBEIN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|