C14H17BrN4O — CID 20964064
1-(2-bromophenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea (PubChem CID 20964064) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 20964064 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-(2-bromophenyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]urea |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C14H17BrN4O/c1-9-11(10(2)19(3)18-9)8-16-14(20)17-13-7-5-4-6-12(13)15/h4-7H,8H2,1-3H3,(H2,16,17,20) |
| InChIKey | BMTNRRKBEFSYKS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |