C25H34ClN3O2S — CID 20967933
3-acetamido-N-[2-[bis(2-methylpropyl)amino]ethyl]-4-(4-chlorophenyl)sulfanylbenzamide (PubChem CID 20967933) has the molecular formula C25H34ClN3O2S and a molecular weight of 476.09 g/mol. Its IUPAC name is 3-acetamido-N-[2-[bis(2-methylpropyl)amino]ethyl]-4-(4-chlorophenyl)sulfanylbenzamide.
| Compound Name | 3-acetamido-N-[2-[bis(2-methylpropyl)amino]ethyl]-4-(4-chlorophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 20967933 |
| Molecular Formula | C25H34ClN3O2S |
| Molecular Weight | 476.09 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 3-acetamido-N-[2-[bis(2-methylpropyl)amino]ethyl]-4-(4-chlorophenyl)sulfanylbenzamide |
| SMILES | CC(=O)Nc1cc(C(=O)NCCN(CC(C)C)CC(C)C)ccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H34ClN3O2S/c1-17(2)15-29(16-18(3)4)13-12-27-25(31)20-6-11-24(23(14-20)28-19(5)30)32-22-9-7-21(26)8-10-22/h6-11,14,17-18H,12-13,15-16H2,1-5H3,(H,27,31)(H,28,30) |
| InChIKey | ZWQBGRRNIAESTK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.09 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |