C22H28N3O3S+ — CID 4052471
3-acetamido-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide (PubChem CID 4052471) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-acetamido-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide.
| Compound Name | 3-acetamido-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 4052471 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-acetamido-4-(4-methylphenyl)sulfanyl-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
| SMILES | CC(=O)Nc1cc(C(=O)NCC[NH+]2CCOCC2)ccc1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-16-3-6-19(7-4-16)29-21-8-5-18(15-20(21)24-17(2)26)22(27)23-9-10-25-11-13-28-14-12-25/h3-8,15H,9-14H2,1-2H3,(H,23,27)(H,24,26)/p+1 |
| InChIKey | XDCWFIBGBBXCGM-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |