C23H29N3O2S — CID 3444820
3-acetamido-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methylphenyl)sulfanylbenzamide (PubChem CID 3444820) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 3-acetamido-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methylphenyl)sulfanylbenzamide.
| Compound Name | 3-acetamido-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methylphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 3444820 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 3-acetamido-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-(4-methylphenyl)sulfanylbenzamide |
| SMILES | CCN1CCCC1CNC(=O)c1ccc(Sc2ccc(C)cc2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-4-26-13-5-6-19(26)15-24-23(28)18-9-12-22(21(14-18)25-17(3)27)29-20-10-7-16(2)8-11-20/h7-12,14,19H,4-6,13,15H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | RNGNAUSXKRUDAO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |