C22H35N3O5 — CID 20968060
1-(1-acetylpiperidin-4-yl)-3-(2,4-dimethoxyphenyl)-1-(3-propan-2-yloxypropyl)urea (PubChem CID 20968060) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(2,4-dimethoxyphenyl)-1-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(2,4-dimethoxyphenyl)-1-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 20968060 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(2,4-dimethoxyphenyl)-1-(3-propan-2-yloxypropyl)urea |
| SMILES | COc1ccc(NC(=O)N(CCCOC(C)C)C2CCN(C(C)=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H35N3O5/c1-16(2)30-14-6-11-25(18-9-12-24(13-10-18)17(3)26)22(27)23-20-8-7-19(28-4)15-21(20)29-5/h7-8,15-16,18H,6,9-14H2,1-5H3,(H,23,27) |
| InChIKey | ZYLIGTTZPDGVSQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|