C28H32N2O2 — CID 20970363
2-[2-(2,4-dimethylphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol (PubChem CID 20970363) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol.
| Compound Name | 2-[2-(2,4-dimethylphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 20970363 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)-4-(4-ethylphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(C2CC(c3ccc(CC)cc3)=NC(c3ccc(C)cc3C)N2)c1O |
| InChI | InChI=1S/C28H32N2O2/c1-5-20-11-13-21(14-12-20)24-17-25(23-8-7-9-26(27(23)31)32-6-2)30-28(29-24)22-15-10-18(3)16-19(22)4/h7-16,25,28,30-31H,5-6,17H2,1-4H3 |
| InChIKey | MGAMIBGLZMRTJA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|