C20H22Cl2N2O4S — CID 20970600
2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(4-ethoxyphenyl)ethanone (PubChem CID 20970600) has the molecular formula C20H22Cl2N2O4S and a molecular weight of 457.38 g/mol. Its IUPAC name is 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(4-ethoxyphenyl)ethanone.
| Compound Name | 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 20970600 |
| Molecular Formula | C20H22Cl2N2O4S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 2-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(C(=O)CN2CCN(S(=O)(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O4S/c1-2-28-17-6-3-15(4-7-17)19(25)14-23-9-11-24(12-10-23)29(26,27)20-13-16(21)5-8-18(20)22/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | GTDUUPQTICCUSE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |