C25H27N3O2S — CID 20972046
2-ethyl-N-[3-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]benzenesulfonamide (PubChem CID 20972046) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-ethyl-N-[3-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]benzenesulfonamide.
| Compound Name | 2-ethyl-N-[3-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20972046 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-ethyl-N-[3-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]benzenesulfonamide |
| SMILES | CCc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2CC)c1 |
| InChI | InChI=1S/C25H27N3O2S/c1-3-20-11-5-8-15-24(20)31(29,30)27-21-12-9-10-19(18-21)16-17-25-26-22-13-6-7-14-23(22)28(25)4-2/h5-15,18,27H,3-4,16-17H2,1-2H3 |
| InChIKey | IDFMGHJCQQMKMK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |