C24H22F3N3O2S — CID 46379481
N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 46379481) has the molecular formula C24H22F3N3O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46379481 |
| Molecular Formula | C24H22F3N3O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCn1c(CCc2ccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C24H22F3N3O2S/c1-2-30-22-9-4-3-8-21(22)28-23(30)15-12-17-10-13-19(14-11-17)29-33(31,32)20-7-5-6-18(16-20)24(25,26)27/h3-11,13-14,16,29H,2,12,15H2,1H3 |
| InChIKey | GYUDFQKTHMUQFI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |