C23H23N3O2S — CID 46379478
N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]-2-ethylbenzenesulfonamide (PubChem CID 46379478) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]-2-ethylbenzenesulfonamide.
| Compound Name | N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]-2-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 46379478 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]-2-ethylbenzenesulfonamide |
| SMILES | CCc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C23H23N3O2S/c1-2-18-9-3-6-13-22(18)29(27,28)26-19-10-7-8-17(16-19)14-15-23-24-20-11-4-5-12-21(20)25-23/h3-13,16,26H,2,14-15H2,1H3,(H,24,25) |
| InChIKey | NCSVGPNMPOMKEV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |