C11H14N2O2 — CID 20976490
3-[2-hydroxy-1-(methylamino)ethyl]-1,3-dihydroindol-2-one (PubChem CID 20976490) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-[2-hydroxy-1-(methylamino)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[2-hydroxy-1-(methylamino)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 20976490 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-[2-hydroxy-1-(methylamino)ethyl]-1,3-dihydroindol-2-one |
| SMILES | CNC(CO)C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H14N2O2/c1-12-9(6-14)10-7-4-2-3-5-8(7)13-11(10)15/h2-5,9-10,12,14H,6H2,1H3,(H,13,15) |
| InChIKey | IUELNUPRZWVDQD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |