C32H34N4O6 — CID 20978769
3,4-dihydroxy-2,5-bis(phenylmethoxy)-N,N'-bis(pyridin-3-ylmethyl)hexanediamide (PubChem CID 20978769) has the molecular formula C32H34N4O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is 3,4-dihydroxy-2,5-bis(phenylmethoxy)-N,N'-bis(pyridin-3-ylmethyl)hexanediamide.
| Compound Name | 3,4-dihydroxy-2,5-bis(phenylmethoxy)-N,N'-bis(pyridin-3-ylmethyl)hexanediamide |
|---|---|
| PubChem CID | 20978769 |
| Molecular Formula | C32H34N4O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3,4-dihydroxy-2,5-bis(phenylmethoxy)-N,N'-bis(pyridin-3-ylmethyl)hexanediamide |
| SMILES | O=C(NCc1cccnc1)C(OCc1ccccc1)C(O)C(O)C(OCc1ccccc1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C32H34N4O6/c37-27(29(41-21-23-9-3-1-4-10-23)31(39)35-19-25-13-7-15-33-17-25)28(38)30(42-22-24-11-5-2-6-12-24)32(40)36-20-26-14-8-16-34-18-26/h1-18,27-30,37-38H,19-22H2,(H,35,39)(H,36,40) |
| InChIKey | LVWYODBPYQNAOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |