C27H36N2O8S — CID 20978894
oxolan-3-yl N-[1-hydroxy-1-[(4-methoxyphenyl)sulfonyl-(oxolan-2-ylmethyl)amino]-2-methyl-3-phenylpropyl]carbamate (PubChem CID 20978894) has the molecular formula C27H36N2O8S and a molecular weight of 548.66 g/mol. Its IUPAC name is oxolan-3-yl N-[1-hydroxy-1-[(4-methoxyphenyl)sulfonyl-(oxolan-2-ylmethyl)amino]-2-methyl-3-phenylpropyl]carbamate.
| Compound Name | oxolan-3-yl N-[1-hydroxy-1-[(4-methoxyphenyl)sulfonyl-(oxolan-2-ylmethyl)amino]-2-methyl-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 20978894 |
| Molecular Formula | C27H36N2O8S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | oxolan-3-yl N-[1-hydroxy-1-[(4-methoxyphenyl)sulfonyl-(oxolan-2-ylmethyl)amino]-2-methyl-3-phenylpropyl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC2CCCO2)C(O)(NC(=O)OC2CCOC2)C(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H36N2O8S/c1-20(17-21-7-4-3-5-8-21)27(31,28-26(30)37-24-14-16-35-19-24)29(18-23-9-6-15-36-23)38(32,33)25-12-10-22(34-2)11-13-25/h3-5,7-8,10-13,20,23-24,31H,6,9,14-19H2,1-2H3,(H,28,30) |
| InChIKey | OWWZIEAWECDEOD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|