C24H38O4Si3 — CID 20979818
1-[2,4-bis(trimethylsilyloxy)phenyl]-2-(2-trimethylsilyloxyphenyl)propan-1-one (PubChem CID 20979818) has the molecular formula C24H38O4Si3 and a molecular weight of 474.82 g/mol. Its IUPAC name is 1-[2,4-bis(trimethylsilyloxy)phenyl]-2-(2-trimethylsilyloxyphenyl)propan-1-one.
| Compound Name | 1-[2,4-bis(trimethylsilyloxy)phenyl]-2-(2-trimethylsilyloxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 20979818 |
| Molecular Formula | C24H38O4Si3 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[2,4-bis(trimethylsilyloxy)phenyl]-2-(2-trimethylsilyloxyphenyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(O[Si](C)(C)C)cc1O[Si](C)(C)C)c1ccccc1O[Si](C)(C)C |
| InChI | InChI=1S/C24H38O4Si3/c1-18(20-13-11-12-14-22(20)27-30(5,6)7)24(25)21-16-15-19(26-29(2,3)4)17-23(21)28-31(8,9)10/h11-18H,1-10H3 |
| InChIKey | FBUFEBKVRPUATO-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|