C32H54O6 — CID 20979977
4-hydroxy-3,5-dimethyl-6-(2,6,12-trihydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl)oxan-2-one (PubChem CID 20979977) has the molecular formula C32H54O6 and a molecular weight of 534.78 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-6-(2,6,12-trihydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl)oxan-2-one.
| Compound Name | 4-hydroxy-3,5-dimethyl-6-(2,6,12-trihydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl)oxan-2-one |
|---|---|
| PubChem CID | 20979977 |
| Molecular Formula | C32H54O6 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-6-(2,6,12-trihydroxy-5,7,9,11,13,15-hexamethylnonadeca-3,8,16,18-tetraenyl)oxan-2-one |
| SMILES | C=CC=CC(C)CC(C)C(O)C(C)CC(C)=CC(C)C(O)C(C)C=CC(O)CC1OC(=O)C(C)C(O)C1C |
| InChI | InChI=1S/C32H54O6/c1-10-11-12-19(2)15-22(5)30(35)24(7)17-20(3)16-23(6)29(34)21(4)13-14-27(33)18-28-25(8)31(36)26(9)32(37)38-28/h10-14,16,19,21-31,33-36H,1,15,17-18H2,2-9H3 |
| InChIKey | LALVYOXFGFMAOZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|