C16H16Cl2N2S — CID 20983786
[2-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;dihydrochloride (PubChem CID 20983786) has the molecular formula C16H16Cl2N2S and a molecular weight of 339.29 g/mol. Its IUPAC name is [2-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;dihydrochloride.
| Compound Name | [2-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 20983786 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [2-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccccc1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H14N2S.2ClH/c17-10-13-8-4-5-9-14(13)16-18-15(11-19-16)12-6-2-1-3-7-12;;/h1-9,11H,10,17H2;2*1H |
| InChIKey | NRELGWGLHQZFPV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |