C20H22ClNO5 — CID 20989058
4-[[3-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 20989058) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 4-[[3-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20989058 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-[[3-chloro-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | COc1cc(CNC(=O)CCC(=O)O)cc(Cl)c1OCc1ccccc1C |
| InChI | InChI=1S/C20H22ClNO5/c1-13-5-3-4-6-15(13)12-27-20-16(21)9-14(10-17(20)26-2)11-22-18(23)7-8-19(24)25/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | YUDXHCBECLZWIF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |