C20H22FNO6 — CID 20989636
4-[[2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid (PubChem CID 20989636) has the molecular formula C20H22FNO6 and a molecular weight of 391.40 g/mol. Its IUPAC name is 4-[[2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20989636 |
| Molecular Formula | C20H22FNO6 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[[2-[2-(4-fluorophenoxy)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid |
| SMILES | COc1cccc(CNC(=O)CCC(=O)O)c1OCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO6/c1-26-17-4-2-3-14(13-22-18(23)9-10-19(24)25)20(17)28-12-11-27-16-7-5-15(21)6-8-16/h2-8H,9-13H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | VYEVGIRAUKSQQS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|