C23H30O5 — CID 20994175
3-[3-methoxy-2-[2-[4-(2-methylbutan-2-yl)phenoxy]ethoxy]phenyl]propanoic acid (PubChem CID 20994175) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-[3-methoxy-2-[2-[4-(2-methylbutan-2-yl)phenoxy]ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-methoxy-2-[2-[4-(2-methylbutan-2-yl)phenoxy]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20994175 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[3-methoxy-2-[2-[4-(2-methylbutan-2-yl)phenoxy]ethoxy]phenyl]propanoic acid |
| SMILES | CCC(C)(C)c1ccc(OCCOc2c(CCC(=O)O)cccc2OC)cc1 |
| InChI | InChI=1S/C23H30O5/c1-5-23(2,3)18-10-12-19(13-11-18)27-15-16-28-22-17(9-14-21(24)25)7-6-8-20(22)26-4/h6-8,10-13H,5,9,14-16H2,1-4H3,(H,24,25) |
| InChIKey | KXABXKNDMJXWBN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|