C13H17BrO3 — CID 20992200
2-(4-bromo-2,3-dimethylphenoxy)-3-methylbutanoic acid (PubChem CID 20992200) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenoxy)-3-methylbutanoic acid.
| Compound Name | 2-(4-bromo-2,3-dimethylphenoxy)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 20992200 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenoxy)-3-methylbutanoic acid |
| SMILES | Cc1c(Br)ccc(OC(C(=O)O)C(C)C)c1C |
| InChI | InChI=1S/C13H17BrO3/c1-7(2)12(13(15)16)17-11-6-5-10(14)8(3)9(11)4/h5-7,12H,1-4H3,(H,15,16) |
| InChIKey | NANFUXONYJCQRS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |