C19H29BrO3 — CID 20994287
2-(2-bromo-4,6-ditert-butylphenoxy)-3-methylbutanoic acid (PubChem CID 20994287) has the molecular formula C19H29BrO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-(2-bromo-4,6-ditert-butylphenoxy)-3-methylbutanoic acid.
| Compound Name | 2-(2-bromo-4,6-ditert-butylphenoxy)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 20994287 |
| Molecular Formula | C19H29BrO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(2-bromo-4,6-ditert-butylphenoxy)-3-methylbutanoic acid |
| SMILES | CC(C)C(Oc1c(Br)cc(C(C)(C)C)cc1C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H29BrO3/c1-11(2)15(17(21)22)23-16-13(19(6,7)8)9-12(10-14(16)20)18(3,4)5/h9-11,15H,1-8H3,(H,21,22) |
| InChIKey | AIWTYBRYWFJXCF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |