C12H15BrO3 — CID 69202867
2-(4-bromo-2,3-dimethylphenoxy)butanoic acid (PubChem CID 69202867) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenoxy)butanoic acid.
| Compound Name | 2-(4-bromo-2,3-dimethylphenoxy)butanoic acid |
|---|---|
| PubChem CID | 69202867 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenoxy)butanoic acid |
| SMILES | CCC(Oc1ccc(Br)c(C)c1C)C(=O)O |
| InChI | InChI=1S/C12H15BrO3/c1-4-10(12(14)15)16-11-6-5-9(13)7(2)8(11)3/h5-6,10H,4H2,1-3H3,(H,14,15) |
| InChIKey | NDCRKCWNTNWIIB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |