4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid

C10H19NO4S — CID 20993217

IUPAC4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid
SMILESCCN(CCCC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H19NO4S/c1-2-11(6-3-4-10(12)13)9-5-7-16(14,15)8-9/h9H,2-8H2,1H3,(H,12,13)
InChIKeyORWSMVLNRLLXIM-UHFFFAOYSA-N
MW249.33 g/mol
LogP0.36
Rot. Bonds6

About 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid

4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid (PubChem CID 20993217) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid.

Molecular Properties

Compound Name4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid
PubChem CID20993217
Molecular FormulaC10H19NO4S
Molecular Weight249.33 g/mol
Exact Mass249.10
IUPAC Name4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid
SMILESCCN(CCCC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C10H19NO4S/c1-2-11(6-3-4-10(12)13)9-5-7-16(14,15)8-9/h9H,2-8H2,1H3,(H,12,13)
InChIKeyORWSMVLNRLLXIM-UHFFFAOYSA-N
XLogP0.36
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.33
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid?
The IUPAC name of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid (CID 20993217) is 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid.
What is the SMILES notation for 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid?
The canonical SMILES for 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid is CCN(CCCC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid?
The InChIKey is ORWSMVLNRLLXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4S/c1-2-11(6-3-4-10(12)13)9-5-7-16(14,15)8-9/h9H,2-8H2,1H3,(H,12,13).
What are the key properties of 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid?
4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid has a molecular weight of 249.33 g/mol, XLogP of 0.36, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothiolan-3-yl)-ethylamino]butanoic acid is sourced from PubChem (CID 20993217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).