C22H23N3O5 — CID 20994830
8-morpholin-4-yl-7-(2-phenoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoxaline (PubChem CID 20994830) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 8-morpholin-4-yl-7-(2-phenoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoxaline.
| Compound Name | 8-morpholin-4-yl-7-(2-phenoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoxaline |
|---|---|
| PubChem CID | 20994830 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 8-morpholin-4-yl-7-(2-phenoxyethoxy)-2,3-dihydro-[1,4]dioxino[2,3-g]quinoxaline |
| SMILES | c1ccc(OCCOc2nc3cc4c(cc3nc2N2CCOCC2)OCCO4)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-2-4-16(5-3-1)27-10-13-30-22-21(25-6-8-26-9-7-25)23-17-14-19-20(15-18(17)24-22)29-12-11-28-19/h1-5,14-15H,6-13H2 |
| InChIKey | VGOXGLNQJBATCO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|