C23H20ClN3O5 — CID 20994918
N-(2-chlorophenyl)-2-[methyl-[2-(4-nitro-2-phenylphenoxy)acetyl]amino]acetamide (PubChem CID 20994918) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[methyl-[2-(4-nitro-2-phenylphenoxy)acetyl]amino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[methyl-[2-(4-nitro-2-phenylphenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 20994918 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-(2-chlorophenyl)-2-[methyl-[2-(4-nitro-2-phenylphenoxy)acetyl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)COc1ccc([N+](=O)[O-])cc1-c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O5/c1-26(14-22(28)25-20-10-6-5-9-19(20)24)23(29)15-32-21-12-11-17(27(30)31)13-18(21)16-7-3-2-4-8-16/h2-13H,14-15H2,1H3,(H,25,28) |
| InChIKey | UTQWFSUGGDQAGP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|