C20H20BrN3O3S3 — CID 2099520
1-[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]phenyl]-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 2099520) has the molecular formula C20H20BrN3O3S3 and a molecular weight of 526.50 g/mol. Its IUPAC name is 1-[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]phenyl]-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]phenyl]-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2099520 |
| Molecular Formula | C20H20BrN3O3S3 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 1-[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]phenyl]-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)Nc1ccc(NC(=S)NCc2cccs2)cc1 |
| InChI | InChI=1S/C20H20BrN3O3S3/c1-2-27-18-10-5-14(21)12-19(18)30(25,26)24-16-8-6-15(7-9-16)23-20(28)22-13-17-4-3-11-29-17/h3-12,24H,2,13H2,1H3,(H2,22,23,28) |
| InChIKey | WLHSYFZGHNCZCI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|