C28H26BF4N3O2 — CID 20997923
(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-(5,7-dimethyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate (PubChem CID 20997923) has the molecular formula C28H26BF4N3O2 and a molecular weight of 523.34 g/mol. Its IUPAC name is (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-(5,7-dimethyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate.
| Compound Name | (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-(5,7-dimethyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 20997923 |
| Molecular Formula | C28H26BF4N3O2 |
| Molecular Weight | 523.34 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-(5,7-dimethyl-2-phenylchromen-4-ylidene)azanium tetrafluoroborate |
| SMILES | Cc1cc(C)c2/c(=[NH+]/c3c(C)n(C)n(-c4ccccc4)c3=O)cc(-c3ccccc3)oc2c1.F[B-](F)(F)F |
| InChI | InChI=1S/C28H25N3O2.BF4/c1-18-15-19(2)26-23(17-24(33-25(26)16-18)21-11-7-5-8-12-21)29-27-20(3)30(4)31(28(27)32)22-13-9-6-10-14-22;2-1(3,4)5/h5-17H,1-4H3;/q;-1/p+1/b29-23+; |
| InChIKey | CISIVNAPJGMJHB-BTCGTBLPSA-O |
| XLogP | 5.13 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|