C21H23N3OS — CID 2099902
4-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)butan-1-one (PubChem CID 2099902) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 2099902 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1-(4-phenylpiperazin-1-yl)butan-1-one |
| SMILES | O=C(CCCc1nc2ccccc2s1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3OS/c25-21(12-6-11-20-22-18-9-4-5-10-19(18)26-20)24-15-13-23(14-16-24)17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2 |
| InChIKey | AZOLWIFGYAOYTE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |