C13H14N2O2S2 — CID 660098
2-(1,3-benzothiazol-2-ylsulfanyl)-1-morpholin-4-ylethanone (PubChem CID 660098) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-1-morpholin-4-ylethanone.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 660098 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-morpholin-4-ylethanone |
| SMILES | O=C(CSc1nc2ccccc2s1)N1CCOCC1 |
| InChI | InChI=1S/C13H14N2O2S2/c16-12(15-5-7-17-8-6-15)9-18-13-14-10-3-1-2-4-11(10)19-13/h1-4H,5-9H2 |
| InChIKey | DFUSVDDRPXIIHL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |