C14H16N2OS2 — CID 659684
1-(1,3-benzothiazol-2-ylsulfanylmethyl)azepan-2-one (PubChem CID 659684) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylsulfanylmethyl)azepan-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-ylsulfanylmethyl)azepan-2-one |
|---|---|
| PubChem CID | 659684 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylsulfanylmethyl)azepan-2-one |
| SMILES | O=C1CCCCCN1CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H16N2OS2/c17-13-8-2-1-5-9-16(13)10-18-14-15-11-6-3-4-7-12(11)19-14/h3-4,6-7H,1-2,5,8-10H2 |
| InChIKey | KRMYPFNABQFRFT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |