C23H15BrN2O3 — CID 20999041
(4-bromophenyl) 6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxylate (PubChem CID 20999041) has the molecular formula C23H15BrN2O3 and a molecular weight of 447.29 g/mol. Its IUPAC name is (4-bromophenyl) 6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxylate.
| Compound Name | (4-bromophenyl) 6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxylate |
|---|---|
| PubChem CID | 20999041 |
| Molecular Formula | C23H15BrN2O3 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | (4-bromophenyl) 6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C23H15BrN2O3/c24-17-11-13-18(14-12-17)29-23(28)20-19(15-7-3-1-4-8-15)21(25-26-22(20)27)16-9-5-2-6-10-16/h1-14H,(H,26,27) |
| InChIKey | VZEOPMLYSVKGIJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|