C25H22N2O5S — CID 20999126
2-phenoxyethyl 5-methyl-4-oxo-3-(1-oxo-1-phenylpropan-2-yl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 20999126) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-phenoxyethyl 5-methyl-4-oxo-3-(1-oxo-1-phenylpropan-2-yl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-phenoxyethyl 5-methyl-4-oxo-3-(1-oxo-1-phenylpropan-2-yl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 20999126 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-phenoxyethyl 5-methyl-4-oxo-3-(1-oxo-1-phenylpropan-2-yl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OCCOc2ccccc2)sc2ncn(C(C)C(=O)c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C25H22N2O5S/c1-16-20-23(33-22(16)25(30)32-14-13-31-19-11-7-4-8-12-19)26-15-27(24(20)29)17(2)21(28)18-9-5-3-6-10-18/h3-12,15,17H,13-14H2,1-2H3 |
| InChIKey | NMZKTKJKXYMDDG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|