C22H22N6OS — CID 21004386
4-(furan-2-ylmethylsulfanyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazoline (PubChem CID 21004386) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfanyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazoline.
| Compound Name | 4-(furan-2-ylmethylsulfanyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazoline |
|---|---|
| PubChem CID | 21004386 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 4-(furan-2-ylmethylsulfanyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazoline |
| SMILES | c1cnc(N2CCN(Cc3nc(SCc4ccco4)c4ccccc4n3)CC2)nc1 |
| InChI | InChI=1S/C22H22N6OS/c1-2-7-19-18(6-1)21(30-16-17-5-3-14-29-17)26-20(25-19)15-27-10-12-28(13-11-27)22-23-8-4-9-24-22/h1-9,14H,10-13,15-16H2 |
| InChIKey | NVXLFZOUZQPAAO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |