C17H21N3O5S — CID 21007449
4-[3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl]piperazine-1-carbaldehyde (PubChem CID 21007449) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-[3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 21007449 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-[3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzoyl]piperazine-1-carbaldehyde |
| SMILES | CC1(C)CS(=O)(=O)N(c2cccc(C(=O)N3CCN(C=O)CC3)c2)C1=O |
| InChI | InChI=1S/C17H21N3O5S/c1-17(2)11-26(24,25)20(16(17)23)14-5-3-4-13(10-14)15(22)19-8-6-18(12-21)7-9-19/h3-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | QBKRKABWZYPTLP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|