C21H19N3OS — CID 21010234
4-[[5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-3-methylphenol (PubChem CID 21010234) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[[5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-3-methylphenol.
| Compound Name | 4-[[5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-3-methylphenol |
|---|---|
| PubChem CID | 21010234 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-[[5-(3,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-3-methylphenol |
| SMILES | Cc1ccc(-c2csc3ncnc(Nc4ccc(O)cc4C)c23)cc1C |
| InChI | InChI=1S/C21H19N3OS/c1-12-4-5-15(8-13(12)2)17-10-26-21-19(17)20(22-11-23-21)24-18-7-6-16(25)9-14(18)3/h4-11,25H,1-3H3,(H,22,23,24) |
| InChIKey | VZXPACCFJDXOQO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|