C19H24N4OS2 — CID 21012720
2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone (PubChem CID 21012720) has the molecular formula C19H24N4OS2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 21012720 |
| Molecular Formula | C19H24N4OS2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[[5-(phenylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone |
| SMILES | C=CCn1c(CSc2ccccc2)nnc1SCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H24N4OS2/c1-2-11-23-17(14-25-16-9-5-3-6-10-16)20-21-19(23)26-15-18(24)22-12-7-4-8-13-22/h2-3,5-6,9-10H,1,4,7-8,11-15H2 |
| InChIKey | MQCFERKFZAACJO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|