C19H24N6O2S — CID 24522323
4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 24522323) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is 4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 24522323 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | C=CCn1c(C)nnc1SCC(=O)N1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C19H24N6O2S/c1-3-9-25-15(2)21-22-19(25)28-14-17(26)23-10-12-24(13-11-23)18(27)20-16-7-5-4-6-8-16/h3-8H,1,9-14H2,2H3,(H,20,27) |
| InChIKey | QJGVKEMBFPJCIR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|