C20H26N6O2S — CID 24523874
N-phenyl-4-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]piperazine-1-carboxamide (PubChem CID 24523874) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is N-phenyl-4-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]piperazine-1-carboxamide.
| Compound Name | N-phenyl-4-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 24523874 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-phenyl-4-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetyl]piperazine-1-carboxamide |
| SMILES | O=C(CSc1nnc2n1CCCCC2)N1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N6O2S/c27-18(15-29-20-23-22-17-9-5-2-6-10-26(17)20)24-11-13-25(14-12-24)19(28)21-16-7-3-1-4-8-16/h1,3-4,7-8H,2,5-6,9-15H2,(H,21,28) |
| InChIKey | QOQYFLVJXJPDJG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |