C27H27N5O2S3 — CID 21013077
2-[2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 21013077) has the molecular formula C27H27N5O2S3 and a molecular weight of 549.75 g/mol. Its IUPAC name is 2-[2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 21013077 |
| Molecular Formula | C27H27N5O2S3 |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2-[2-[[4-phenyl-5-(phenylsulfanylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(Sc1nnc(CSc2ccccc2)n1-c1ccccc1)C(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C27H27N5O2S3/c1-17(25(34)29-26-23(24(28)33)20-14-8-9-15-21(20)37-26)36-27-31-30-22(16-35-19-12-6-3-7-13-19)32(27)18-10-4-2-5-11-18/h2-7,10-13,17H,8-9,14-16H2,1H3,(H2,28,33)(H,29,34) |
| InChIKey | MWSHGKAHSMMWEL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |