C24H29N5O4S3 — CID 23407574
2-[2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 23407574) has the molecular formula C24H29N5O4S3 and a molecular weight of 547.73 g/mol. Its IUPAC name is 2-[2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 23407574 |
| Molecular Formula | C24H29N5O4S3 |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 2-[2-[[4-ethyl-5-[(4-methylphenyl)sulfonylmethyl]-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(CS(=O)(=O)c2ccc(C)cc2)nnc1SC(C)C(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C24H29N5O4S3/c1-4-29-19(13-36(32,33)16-11-9-14(2)10-12-16)27-28-24(29)34-15(3)22(31)26-23-20(21(25)30)17-7-5-6-8-18(17)35-23/h9-12,15H,4-8,13H2,1-3H3,(H2,25,30)(H,26,31) |
| InChIKey | XMIUFZAZOJAANI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |