C25H29N5O2S3 — CID 21013829
2-[2-[[5-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 21013829) has the molecular formula C25H29N5O2S3 and a molecular weight of 527.74 g/mol. Its IUPAC name is 2-[2-[[5-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-[[5-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 21013829 |
| Molecular Formula | C25H29N5O2S3 |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 2-[2-[[5-[(4-methylphenyl)sulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCn1c(CSc2ccc(C)cc2)nnc1SC(C)C(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C25H29N5O2S3/c1-4-13-30-20(14-33-17-11-9-15(2)10-12-17)28-29-25(30)34-16(3)23(32)27-24-21(22(26)31)18-7-5-6-8-19(18)35-24/h4,9-12,16H,1,5-8,13-14H2,2-3H3,(H2,26,31)(H,27,32) |
| InChIKey | RGGNYXLADLCRQO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|