C10H8F2NOY+2 — CID 21021853
3-(3,4-difluorophenyl)-5-methanidyl-4,5-dihydro-1,2-oxazole;yttrium(3+) (PubChem CID 21021853) has the molecular formula C10H8F2NOY+2 and a molecular weight of 285.08 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-5-methanidyl-4,5-dihydro-1,2-oxazole;yttrium(3+).
| Compound Name | 3-(3,4-difluorophenyl)-5-methanidyl-4,5-dihydro-1,2-oxazole;yttrium(3+) |
|---|---|
| PubChem CID | 21021853 |
| Molecular Formula | C10H8F2NOY+2 |
| Molecular Weight | 285.08 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 3-(3,4-difluorophenyl)-5-methanidyl-4,5-dihydro-1,2-oxazole;yttrium(3+) |
| SMILES | [CH2-]C1CC(c2ccc(F)c(F)c2)=NO1.[Y+3] |
| InChI | InChI=1S/C10H8F2NO.Y/c1-6-4-10(13-14-6)7-2-3-8(11)9(12)5-7;/h2-3,5-6H,1,4H2;/q-1;+3 |
| InChIKey | YPWRNIKBZBMROS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|