C28H21N3O3S — CID 21022406
[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-pyridin-3-ylthiophen-2-yl)methanone (PubChem CID 21022406) has the molecular formula C28H21N3O3S and a molecular weight of 479.56 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-pyridin-3-ylthiophen-2-yl)methanone.
| Compound Name | [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-pyridin-3-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 21022406 |
| Molecular Formula | C28H21N3O3S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-pyridin-3-ylthiophen-2-yl)methanone |
| SMILES | O=C(c1ccc(-c2cccnc2)s1)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H21N3O3S/c32-28(25-10-9-24(35-25)18-4-3-12-29-15-18)31-13-11-20-19-5-1-2-6-21(19)30-26(20)27(31)17-7-8-22-23(14-17)34-16-33-22/h1-10,12,14-15,27,30H,11,13,16H2 |
| InChIKey | SXNSDLOSPJADOY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|