C19H15BrN4O3 — CID 2102294
(5R)-5-benzyl-3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 2102294) has the molecular formula C19H15BrN4O3 and a molecular weight of 427.26 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2102294 |
| Molecular Formula | C19H15BrN4O3 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | (5R)-5-benzyl-3-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2ccccc2)C(=O)N1Cc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C19H15BrN4O3/c20-14-9-5-4-8-13(14)17-23-22-16(27-17)11-24-18(25)15(21-19(24)26)10-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,21,26)/t15-/m1/s1 |
| InChIKey | MLRWRWGURXFZOJ-OAHLLOKOSA-N |
| XLogP | 3.16 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|