C10H16O2S — CID 21023525
2,4,6-trimethyl-1-methylsulfonylcyclohexa-1,3-diene (PubChem CID 21023525) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-methylsulfonylcyclohexa-1,3-diene.
| Compound Name | 2,4,6-trimethyl-1-methylsulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 21023525 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2,4,6-trimethyl-1-methylsulfonylcyclohexa-1,3-diene |
| SMILES | CC1=CC(C)=C(S(C)(=O)=O)C(C)C1 |
| InChI | InChI=1S/C10H16O2S/c1-7-5-8(2)10(9(3)6-7)13(4,11)12/h5,9H,6H2,1-4H3 |
| InChIKey | VJHPBIBWFYJTQG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |